Hydroxyethyl Cellulose CAS# 9004-62-0
| Hydroxyethyl Cellulose Basic information |
| Thickeners and binders?Chemical properties?Uses?Production methods |
| Product Name: | Hydroxyethyl Cellulose |
| Synonyms: | ah15;aw15(polysaccharide);aw15[polysaccharide];bl15;Natrosol L 250;hydrdoxyethyl cellulose;2-HYDROXYETHYL CELLULOSE, AVERAGE MV CA. 90,000;2-HYDROXYETHYL CELLULOSE, AVERAGE MV CA. 1,300,000 |
| CAS: | 9004-62-0 |
| MF: | C29H52O21 |
| MW: | 0 |
| EINECS: | 618-387-5 |
| Product Categories: | Cellulose;pharmaceutical,food,Construction;Carbohydrates;Carbohydrates A to;Carbohydrates H-LBiochemicals and Reagents;Polysaccharide;Cnbio;Materials Science;Natural Polymers;Polymer Science;Polymers;Natural Polymers;Polymer Science;cosmetic;Disinfectants;bc0001;9004-62-0;HEC |
| Mol File: | Mol File |
| Hydroxyethyl Cellulose Chemical Properties |
| Melting point | 288-290???C (dec.) |
| density | 0.75?g/mL?at 25???C(lit.) |
| storage temp. | 2-8??C |
| solubility | H2O: ??5?wt. % at?20???C |
| form | powder |
| color | hite to yellowish fibrous |
| Odor | Odorless |
| PH | pH(20g/l,25??) : 5.0??8.0 |
| Water Solubility | almost transparency |
| Merck | 14,4673 |
| Stability: | Stable. Incompatible with strong oxidizing agents, acid chlorides, acid anhydrides |
| InChIKey | CWSZBVAUYPTXTG-UHFFFAOYSA-N |
| SMILES | O1C(CO)C(OC2C(O)C(O)C(OC3C(OCCO)C(O)C(OC)C(CO)O3)C(COC3C(O)C(O)C(OC)C(CO)O3)O2)C(O)C(O)C1C |
| CAS DataBase Reference | 9004-62-0(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Hydroxyethyl cellulose (9004-62-0) |
| Safety Information |
| Hazard Codes | T |
| Risk Statements | 23/24/25-36/37/38 |
| Safety Statements | 26-36-45-24/25-22 |
| WGK Germany | 3 |
| RTECS | FJ5958000 |
| F | 3 |
| Autoignition Temperature | 725 ??F |
| HS Code | 39123980 |
| Hazardous Substances Data | 9004-62-0(Hazardous Substances Data) |
| Toxicity | LDLo intravenous in women: 5100mg/kg/6D- |
